C8H7F5N4O3 — CID 112500504
2-(2-nitroimidazol-1-yl)-N-(2,2,3,3,3-penta(18F)fluoropropyl)acetamide (PubChem CID 112500504) has the molecular formula C8H7F5N4O3 and a molecular weight of 297.17 g/mol. Its IUPAC name is 2-(2-nitroimidazol-1-yl)-N-(2,2,3,3,3-penta(18F)fluoropropyl)acetamide.
| Compound Name | 2-(2-nitroimidazol-1-yl)-N-(2,2,3,3,3-penta(18F)fluoropropyl)acetamide |
|---|---|
| PubChem CID | 112500504 |
| Molecular Formula | C8H7F5N4O3 |
| Molecular Weight | 297.17 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 2-(2-nitroimidazol-1-yl)-N-(2,2,3,3,3-penta(18F)fluoropropyl)acetamide |
| SMILES | O=C(Cn1ccnc1[N+](=O)[O-])NCC([18F])([18F])C([18F])([18F])[18F] |
| InChI | InChI=1S/C8H7F5N4O3/c9-7(10,8(11,12)13)4-15-5(18)3-16-2-1-14-6(16)17(19)20/h1-2H,3-4H2,(H,15,18)/i9-1,10-1,11-1,12-1,13-1 |
| InChIKey | JGGDSDPOPRWSCX-YUEAXVSCSA-N |
| XLogP | 1.11 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.17 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|