C33H42N2O3Si2 — CID 11250053
(4S,5R)-3-[(2R,3R)-3-benzyl-1-[bis(trimethylsilyl)methyl]-2-methyl-4-oxoazetidin-3-yl]-4,5-diphenyl-1,3-oxazolidin-2-one (PubChem CID 11250053) has the molecular formula C33H42N2O3Si2 and a molecular weight of 570.88 g/mol. Its IUPAC name is (4S,5R)-3-[(2R,3R)-3-benzyl-1-[bis(trimethylsilyl)methyl]-2-methyl-4-oxoazetidin-3-yl]-4,5-diphenyl-1,3-oxazolidin-2-one.
| Compound Name | (4S,5R)-3-[(2R,3R)-3-benzyl-1-[bis(trimethylsilyl)methyl]-2-methyl-4-oxoazetidin-3-yl]-4,5-diphenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11250053 |
| Molecular Formula | C33H42N2O3Si2 |
| Molecular Weight | 570.88 g/mol |
| Exact Mass | 570.27 |
| IUPAC Name | (4S,5R)-3-[(2R,3R)-3-benzyl-1-[bis(trimethylsilyl)methyl]-2-methyl-4-oxoazetidin-3-yl]-4,5-diphenyl-1,3-oxazolidin-2-one |
| SMILES | C[C@H]1N(C([Si](C)(C)C)[Si](C)(C)C)C(=O)[C@]1(Cc1ccccc1)N1C(=O)O[C@H](c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C33H42N2O3Si2/c1-24-33(23-25-17-11-8-12-18-25,30(36)34(24)32(39(2,3)4)40(5,6)7)35-28(26-19-13-9-14-20-26)29(38-31(35)37)27-21-15-10-16-22-27/h8-22,24,28-29,32H,23H2,1-7H3/t24-,28+,29-,33-/m1/s1 |
| InChIKey | BRUDLAPQVWNAOF-SKWRWUNHSA-N |
| XLogP | 7.26 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.88 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|