C16H18N2O2S — CID 112500907
2-[2-(phenoxymethyl)-1,3-thiazol-4-yl]-1-pyrrolidin-1-ylethanone (PubChem CID 112500907) has the molecular formula C16H18N2O2S and a molecular weight of 302.40 g/mol. Its IUPAC name is 2-[2-(phenoxymethyl)-1,3-thiazol-4-yl]-1-pyrrolidin-1-ylethanone.
| Compound Name | 2-[2-(phenoxymethyl)-1,3-thiazol-4-yl]-1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 112500907 |
| Molecular Formula | C16H18N2O2S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 2-[2-(phenoxymethyl)-1,3-thiazol-4-yl]-1-pyrrolidin-1-ylethanone |
| SMILES | O=C(Cc1csc(COc2ccccc2)n1)N1CCCC1 |
| InChI | InChI=1S/C16H18N2O2S/c19-16(18-8-4-5-9-18)10-13-12-21-15(17-13)11-20-14-6-2-1-3-7-14/h1-3,6-7,12H,4-5,8-11H2 |
| InChIKey | ATXDJHZZJBILEG-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |