About 3-N,3-N-dimethyl-4-quinolin-8-yloxybutane-1,3-diamine
3-N,3-N-dimethyl-4-quinolin-8-yloxybutane-1,3-diamine (PubChem CID 112501008) has the molecular formula C15H21N3O
and a molecular weight of 259.35 g/mol. Its IUPAC name is 3-N,3-N-dimethyl-4-quinolin-8-yloxybutane-1,3-diamine.
Molecular Properties
| Compound Name | 3-N,3-N-dimethyl-4-quinolin-8-yloxybutane-1,3-diamine |
| PubChem CID | 112501008 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 3-N,3-N-dimethyl-4-quinolin-8-yloxybutane-1,3-diamine |
| SMILES | CN(C)C(CCN)COc1cccc2cccnc12 |
| InChI | InChI=1S/C15H21N3O/c1-18(2)13(8-9-16)11-19-14-7-3-5-12-6-4-10-17-15(12)14/h3-7,10,13H,8-9,11,16H2,1-2H3 |
| InChIKey | LAVVQKOAOFOLIV-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-N,3-N-dimethyl-4-quinolin-8-yloxybutane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N,3-N-dimethyl-4-quinolin-8-yloxybutane-1,3-diamine?
The IUPAC name of 3-N,3-N-dimethyl-4-quinolin-8-yloxybutane-1,3-diamine (CID 112501008) is 3-N,3-N-dimethyl-4-quinolin-8-yloxybutane-1,3-diamine.
What is the SMILES notation for 3-N,3-N-dimethyl-4-quinolin-8-yloxybutane-1,3-diamine?
The canonical SMILES for 3-N,3-N-dimethyl-4-quinolin-8-yloxybutane-1,3-diamine is CN(C)C(CCN)COc1cccc2cccnc12.
What is the InChIKey of 3-N,3-N-dimethyl-4-quinolin-8-yloxybutane-1,3-diamine?
The InChIKey is LAVVQKOAOFOLIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3O/c1-18(2)13(8-9-16)11-19-14-7-3-5-12-6-4-10-17-15(12)14/h3-7,10,13H,8-9,11,16H2,1-2H3.
What are the key properties of 3-N,3-N-dimethyl-4-quinolin-8-yloxybutane-1,3-diamine?
3-N,3-N-dimethyl-4-quinolin-8-yloxybutane-1,3-diamine has a molecular weight of 259.35 g/mol, XLogP of 1.89, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N,3-N-dimethyl-4-quinolin-8-yloxybutane-1,3-diamine is sourced from PubChem (CID 112501008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).