C35H51NO6 — CID 11250192
tert-butyl (2S,3R,5S,6S,8R)-3-hydroxy-6,8-dimethyl-2-[(1R,3R)-3-methyl-1,5-bis(phenylmethoxy)pentyl]-1-oxa-10-azaspiro[4.5]decane-10-carboxylate (PubChem CID 11250192) has the molecular formula C35H51NO6 and a molecular weight of 581.79 g/mol. Its IUPAC name is tert-butyl (2S,3R,5S,6S,8R)-3-hydroxy-6,8-dimethyl-2-[(1R,3R)-3-methyl-1,5-bis(phenylmethoxy)pentyl]-1-oxa-10-azaspiro[4.5]decane-10-carboxylate.
| Compound Name | tert-butyl (2S,3R,5S,6S,8R)-3-hydroxy-6,8-dimethyl-2-[(1R,3R)-3-methyl-1,5-bis(phenylmethoxy)pentyl]-1-oxa-10-azaspiro[4.5]decane-10-carboxylate |
|---|---|
| PubChem CID | 11250192 |
| Molecular Formula | C35H51NO6 |
| Molecular Weight | 581.79 g/mol |
| Exact Mass | 581.37 |
| IUPAC Name | tert-butyl (2S,3R,5S,6S,8R)-3-hydroxy-6,8-dimethyl-2-[(1R,3R)-3-methyl-1,5-bis(phenylmethoxy)pentyl]-1-oxa-10-azaspiro[4.5]decane-10-carboxylate |
| SMILES | C[C@H](CCOCc1ccccc1)C[C@@H](OCc1ccccc1)[C@H]1O[C@@]2(C[C@H]1O)[C@@H](C)C[C@@H](C)CN2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C35H51NO6/c1-25(17-18-39-23-28-13-9-7-10-14-28)20-31(40-24-29-15-11-8-12-16-29)32-30(37)21-35(41-32)27(3)19-26(2)22-36(35)33(38)42-34(4,5)6/h7-16,25-27,30-32,37H,17-24H2,1-6H3/t25-,26-,27+,30-,31-,32+,35+/m1/s1 |
| InChIKey | FNMFIHOGHWDMRJ-GXSBNNKWSA-N |
| XLogP | 6.96 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.79 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|