C21H28N2O — CID 112504225
N-[2-(diethylamino)-2-(4-methylphenyl)ethyl]-2-phenylacetamide (PubChem CID 112504225) has the molecular formula C21H28N2O and a molecular weight of 324.47 g/mol. Its IUPAC name is N-[2-(diethylamino)-2-(4-methylphenyl)ethyl]-2-phenylacetamide.
| Compound Name | N-[2-(diethylamino)-2-(4-methylphenyl)ethyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 112504225 |
| Molecular Formula | C21H28N2O |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | N-[2-(diethylamino)-2-(4-methylphenyl)ethyl]-2-phenylacetamide |
| SMILES | CCN(CC)C(CNC(=O)Cc1ccccc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H28N2O/c1-4-23(5-2)20(19-13-11-17(3)12-14-19)16-22-21(24)15-18-9-7-6-8-10-18/h6-14,20H,4-5,15-16H2,1-3H3,(H,22,24) |
| InChIKey | INQYJPJZPYUFBI-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |