C35H45NO6Si — CID 11250423
(2S,4aR,5S,7S)-7-[tert-butyl(diphenyl)silyl]oxy-2-[2-(methoxymethoxy)ethyl]-5-phenylmethoxy-3,4,4a,5,6,7-hexahydro-2H-pyrido[1,2-b]oxazin-8-one (PubChem CID 11250423) has the molecular formula C35H45NO6Si and a molecular weight of 603.83 g/mol. Its IUPAC name is (2S,4aR,5S,7S)-7-[tert-butyl(diphenyl)silyl]oxy-2-[2-(methoxymethoxy)ethyl]-5-phenylmethoxy-3,4,4a,5,6,7-hexahydro-2H-pyrido[1,2-b]oxazin-8-one.
| Compound Name | (2S,4aR,5S,7S)-7-[tert-butyl(diphenyl)silyl]oxy-2-[2-(methoxymethoxy)ethyl]-5-phenylmethoxy-3,4,4a,5,6,7-hexahydro-2H-pyrido[1,2-b]oxazin-8-one |
|---|---|
| PubChem CID | 11250423 |
| Molecular Formula | C35H45NO6Si |
| Molecular Weight | 603.83 g/mol |
| Exact Mass | 603.30 |
| IUPAC Name | (2S,4aR,5S,7S)-7-[tert-butyl(diphenyl)silyl]oxy-2-[2-(methoxymethoxy)ethyl]-5-phenylmethoxy-3,4,4a,5,6,7-hexahydro-2H-pyrido[1,2-b]oxazin-8-one |
| SMILES | COCOCC[C@@H]1CC[C@@H]2[C@@H](OCc3ccccc3)C[C@H](O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)C(=O)N2O1 |
| InChI | InChI=1S/C35H45NO6Si/c1-35(2,3)43(29-16-10-6-11-17-29,30-18-12-7-13-19-30)42-33-24-32(40-25-27-14-8-5-9-15-27)31-21-20-28(22-23-39-26-38-4)41-36(31)34(33)37/h5-19,28,31-33H,20-26H2,1-4H3/t28-,31+,32-,33-/m0/s1 |
| InChIKey | INXWKKVEPRBESK-KJNVUWGSSA-N |
| XLogP | 5.22 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.83 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|