C34H36ClF2N3O3 — CID 11250463
8-[4-[3-(2-chloro-3,6-difluorophenoxy)propyl]phenyl]-N-cyclopropyl-N-[(2-methoxy-3-methyl-4-pyridinyl)methyl]-5-azaspiro[2.5]oct-7-ene-7-carboxamide (PubChem CID 11250463) has the molecular formula C34H36ClF2N3O3 and a molecular weight of 608.13 g/mol. Its IUPAC name is 8-[4-[3-(2-chloro-3,6-difluorophenoxy)propyl]phenyl]-N-cyclopropyl-N-[(2-methoxy-3-methyl-4-pyridinyl)methyl]-5-azaspiro[2.5]oct-7-ene-7-carboxamide.
| Compound Name | 8-[4-[3-(2-chloro-3,6-difluorophenoxy)propyl]phenyl]-N-cyclopropyl-N-[(2-methoxy-3-methyl-4-pyridinyl)methyl]-5-azaspiro[2.5]oct-7-ene-7-carboxamide |
|---|---|
| PubChem CID | 11250463 |
| Molecular Formula | C34H36ClF2N3O3 |
| Molecular Weight | 608.13 g/mol |
| Exact Mass | 607.24 |
| IUPAC Name | 8-[4-[3-(2-chloro-3,6-difluorophenoxy)propyl]phenyl]-N-cyclopropyl-N-[(2-methoxy-3-methyl-4-pyridinyl)methyl]-5-azaspiro[2.5]oct-7-ene-7-carboxamide |
| SMILES | COc1nccc(CN(C(=O)C2=C(c3ccc(CCCOc4c(F)ccc(F)c4Cl)cc3)C3(CC3)CNC2)C2CC2)c1C |
| InChI | InChI=1S/C34H36ClF2N3O3/c1-21-24(13-16-39-32(21)42-2)19-40(25-9-10-25)33(41)26-18-38-20-34(14-15-34)29(26)23-7-5-22(6-8-23)4-3-17-43-31-28(37)12-11-27(36)30(31)35/h5-8,11-13,16,25,38H,3-4,9-10,14-15,17-20H2,1-2H3 |
| InChIKey | UKOXQXYMTIKTOH-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.13 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|