C17H24ClN3O3 — CID 112504722
ethyl 2-[[2-(2-chlorophenyl)-2-(4-methylpiperazin-1-yl)ethyl]amino]-2-oxoacetate (PubChem CID 112504722) has the molecular formula C17H24ClN3O3 and a molecular weight of 353.85 g/mol. Its IUPAC name is ethyl 2-[[2-(2-chlorophenyl)-2-(4-methylpiperazin-1-yl)ethyl]amino]-2-oxoacetate.
| Compound Name | ethyl 2-[[2-(2-chlorophenyl)-2-(4-methylpiperazin-1-yl)ethyl]amino]-2-oxoacetate |
|---|---|
| PubChem CID | 112504722 |
| Molecular Formula | C17H24ClN3O3 |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | ethyl 2-[[2-(2-chlorophenyl)-2-(4-methylpiperazin-1-yl)ethyl]amino]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)NCC(c1ccccc1Cl)N1CCN(C)CC1 |
| InChI | InChI=1S/C17H24ClN3O3/c1-3-24-17(23)16(22)19-12-15(13-6-4-5-7-14(13)18)21-10-8-20(2)9-11-21/h4-7,15H,3,8-12H2,1-2H3,(H,19,22) |
| InChIKey | VKJDOTKZJVFPHQ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|