C25H47IO5Si2 — CID 11250485
6-[(E,2R,4R)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-7-iodohept-6-enyl]-2,2-dimethyl-1,3-dioxin-4-one (PubChem CID 11250485) has the molecular formula C25H47IO5Si2 and a molecular weight of 610.72 g/mol. Its IUPAC name is 6-[(E,2R,4R)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-7-iodohept-6-enyl]-2,2-dimethyl-1,3-dioxin-4-one.
| Compound Name | 6-[(E,2R,4R)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-7-iodohept-6-enyl]-2,2-dimethyl-1,3-dioxin-4-one |
|---|---|
| PubChem CID | 11250485 |
| Molecular Formula | C25H47IO5Si2 |
| Molecular Weight | 610.72 g/mol |
| Exact Mass | 610.20 |
| IUPAC Name | 6-[(E,2R,4R)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-7-iodohept-6-enyl]-2,2-dimethyl-1,3-dioxin-4-one |
| SMILES | CC1(C)OC(=O)C=C(C[C@@H](C[C@@H](C/C=C/I)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C25H47IO5Si2/c1-23(2,3)32(9,10)30-19(14-13-15-26)16-21(31-33(11,12)24(4,5)6)17-20-18-22(27)29-25(7,8)28-20/h13,15,18-19,21H,14,16-17H2,1-12H3/b15-13+/t19-,21-/m1/s1 |
| InChIKey | MNPRRTWBPGIYQK-CQRFJCNGSA-N |
| XLogP | 8.08 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.72 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|