C19H31N3O2S — CID 112505124
N-[[1-(4-phenylpiperazin-1-yl)cyclohexyl]methyl]ethanesulfonamide (PubChem CID 112505124) has the molecular formula C19H31N3O2S and a molecular weight of 365.54 g/mol. Its IUPAC name is N-[[1-(4-phenylpiperazin-1-yl)cyclohexyl]methyl]ethanesulfonamide.
| Compound Name | N-[[1-(4-phenylpiperazin-1-yl)cyclohexyl]methyl]ethanesulfonamide |
|---|---|
| PubChem CID | 112505124 |
| Molecular Formula | C19H31N3O2S |
| Molecular Weight | 365.54 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | N-[[1-(4-phenylpiperazin-1-yl)cyclohexyl]methyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NCC1(N2CCN(c3ccccc3)CC2)CCCCC1 |
| InChI | InChI=1S/C19H31N3O2S/c1-2-25(23,24)20-17-19(11-7-4-8-12-19)22-15-13-21(14-16-22)18-9-5-3-6-10-18/h3,5-6,9-10,20H,2,4,7-8,11-17H2,1H3 |
| InChIKey | HVUBDJRALKABPT-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.54 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |