C20H33N3O2 — CID 112505226
N-[2-(4-ethylpiperazin-1-yl)-2-(4-methoxyphenyl)ethyl]pentanamide (PubChem CID 112505226) has the molecular formula C20H33N3O2 and a molecular weight of 347.50 g/mol. Its IUPAC name is N-[2-(4-ethylpiperazin-1-yl)-2-(4-methoxyphenyl)ethyl]pentanamide.
| Compound Name | N-[2-(4-ethylpiperazin-1-yl)-2-(4-methoxyphenyl)ethyl]pentanamide |
|---|---|
| PubChem CID | 112505226 |
| Molecular Formula | C20H33N3O2 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.26 |
| IUPAC Name | N-[2-(4-ethylpiperazin-1-yl)-2-(4-methoxyphenyl)ethyl]pentanamide |
| SMILES | CCCCC(=O)NCC(c1ccc(OC)cc1)N1CCN(CC)CC1 |
| InChI | InChI=1S/C20H33N3O2/c1-4-6-7-20(24)21-16-19(17-8-10-18(25-3)11-9-17)23-14-12-22(5-2)13-15-23/h8-11,19H,4-7,12-16H2,1-3H3,(H,21,24) |
| InChIKey | KYHYGJUGQDFNFK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |