C14H18N2O5S — CID 112505824
ethyl 2-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-methylanilino]-2-oxoacetate (PubChem CID 112505824) has the molecular formula C14H18N2O5S and a molecular weight of 326.37 g/mol. Its IUPAC name is ethyl 2-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-methylanilino]-2-oxoacetate.
| Compound Name | ethyl 2-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-methylanilino]-2-oxoacetate |
|---|---|
| PubChem CID | 112505824 |
| Molecular Formula | C14H18N2O5S |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | ethyl 2-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)-4-methylanilino]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)Nc1ccc(C)c(N2CCCS2(=O)=O)c1 |
| InChI | InChI=1S/C14H18N2O5S/c1-3-21-14(18)13(17)15-11-6-5-10(2)12(9-11)16-7-4-8-22(16,19)20/h5-6,9H,3-4,7-8H2,1-2H3,(H,15,17) |
| InChIKey | NVGSMUGLSAZHKZ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|