C19H25N3O3S — CID 112506422
1-(4-methylphenyl)-N-(2-morpholin-4-yl-2-pyridin-3-ylethyl)methanesulfonamide (PubChem CID 112506422) has the molecular formula C19H25N3O3S and a molecular weight of 375.49 g/mol. Its IUPAC name is 1-(4-methylphenyl)-N-(2-morpholin-4-yl-2-pyridin-3-ylethyl)methanesulfonamide.
| Compound Name | 1-(4-methylphenyl)-N-(2-morpholin-4-yl-2-pyridin-3-ylethyl)methanesulfonamide |
|---|---|
| PubChem CID | 112506422 |
| Molecular Formula | C19H25N3O3S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 1-(4-methylphenyl)-N-(2-morpholin-4-yl-2-pyridin-3-ylethyl)methanesulfonamide |
| SMILES | Cc1ccc(CS(=O)(=O)NCC(c2cccnc2)N2CCOCC2)cc1 |
| InChI | InChI=1S/C19H25N3O3S/c1-16-4-6-17(7-5-16)15-26(23,24)21-14-19(18-3-2-8-20-13-18)22-9-11-25-12-10-22/h2-8,13,19,21H,9-12,14-15H2,1H3 |
| InChIKey | UMWUGYGZDMNXPQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |