C33H62O8Si2 — CID 11250744
[(2R,3R,5S)-5-[(2R,3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-4-methyloxan-2-yl]-2-ethenyloxolan-3-yl] (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-7-oxoheptanoate (PubChem CID 11250744) has the molecular formula C33H62O8Si2 and a molecular weight of 643.02 g/mol. Its IUPAC name is [(2R,3R,5S)-5-[(2R,3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-4-methyloxan-2-yl]-2-ethenyloxolan-3-yl] (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-7-oxoheptanoate.
| Compound Name | [(2R,3R,5S)-5-[(2R,3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-4-methyloxan-2-yl]-2-ethenyloxolan-3-yl] (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-7-oxoheptanoate |
|---|---|
| PubChem CID | 11250744 |
| Molecular Formula | C33H62O8Si2 |
| Molecular Weight | 643.02 g/mol |
| Exact Mass | 642.40 |
| IUPAC Name | [(2R,3R,5S)-5-[(2R,3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-4-methyloxan-2-yl]-2-ethenyloxolan-3-yl] (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-7-oxoheptanoate |
| SMILES | C=C[C@H]1O[C@H]([C@@]2(OC)OCC[C@@H](C)[C@H]2O[Si](C)(C)C(C)(C)C)C[C@H]1OC(=O)[C@H](C)[C@H](CCCC=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C33H62O8Si2/c1-15-25-27(39-30(35)24(3)26(18-16-17-20-34)40-42(11,12)31(4,5)6)22-28(38-25)33(36-10)29(23(2)19-21-37-33)41-43(13,14)32(7,8)9/h15,20,23-29H,1,16-19,21-22H2,2-14H3/t23-,24-,25-,26+,27-,28+,29-,33-/m1/s1 |
| InChIKey | MFQUROASVSWTPN-IRQXMAGXSA-N |
| XLogP | 7.43 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.02 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|