C17H28O — CID 112508716
3-(5-tert-butyl-2-methylphenyl)hexan-1-ol (PubChem CID 112508716) has the molecular formula C17H28O and a molecular weight of 248.41 g/mol. Its IUPAC name is 3-(5-tert-butyl-2-methylphenyl)hexan-1-ol.
| Compound Name | 3-(5-tert-butyl-2-methylphenyl)hexan-1-ol |
|---|---|
| PubChem CID | 112508716 |
| Molecular Formula | C17H28O |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.21 |
| IUPAC Name | 3-(5-tert-butyl-2-methylphenyl)hexan-1-ol |
| SMILES | CCCC(CCO)c1cc(C(C)(C)C)ccc1C |
| InChI | InChI=1S/C17H28O/c1-6-7-14(10-11-18)16-12-15(17(3,4)5)9-8-13(16)2/h8-9,12,14,18H,6-7,10-11H2,1-5H3 |
| InChIKey | RLNGRKRHBAGBRS-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |