2-[[3-(3,4-dimethylphenoxy)-2-methylpropanoyl]amino]acetic acid

C14H19NO4 — CID 112509512

IUPAC2-[[3-(3,4-dimethylphenoxy)-2-methylpropanoyl]amino]acetic acid
SMILESCc1ccc(OCC(C)C(=O)NCC(=O)O)cc1C
InChIInChI=1S/C14H19NO4/c1-9-4-5-12(6-10(9)2)19-8-11(3)14(18)15-7-13(16)17/h4-6,11H,7-8H2,1-3H3,(H,15,18)(H,16,17)
InChIKeyITJBLKYXNAQCAD-UHFFFAOYSA-N
MW265.31 g/mol
LogP1.52
Rot. Bonds6

About 2-[[3-(3,4-dimethylphenoxy)-2-methylpropanoyl]amino]acetic acid

2-[[3-(3,4-dimethylphenoxy)-2-methylpropanoyl]amino]acetic acid (PubChem CID 112509512) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is 2-[[3-(3,4-dimethylphenoxy)-2-methylpropanoyl]amino]acetic acid.

Molecular Properties

Compound Name2-[[3-(3,4-dimethylphenoxy)-2-methylpropanoyl]amino]acetic acid
PubChem CID112509512
Molecular FormulaC14H19NO4
Molecular Weight265.31 g/mol
Exact Mass265.13
IUPAC Name2-[[3-(3,4-dimethylphenoxy)-2-methylpropanoyl]amino]acetic acid
SMILESCc1ccc(OCC(C)C(=O)NCC(=O)O)cc1C
InChIInChI=1S/C14H19NO4/c1-9-4-5-12(6-10(9)2)19-8-11(3)14(18)15-7-13(16)17/h4-6,11H,7-8H2,1-3H3,(H,15,18)(H,16,17)
InChIKeyITJBLKYXNAQCAD-UHFFFAOYSA-N
XLogP1.52
TPSA75.63 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500265.31
LogP ≤ 51.52
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-[[3-(3,4-dimethylphenoxy)-2-methylpropanoyl]amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[[3-(3,4-dimethylphenoxy)-2-methylpropanoyl]amino]acetic acid?
The IUPAC name of 2-[[3-(3,4-dimethylphenoxy)-2-methylpropanoyl]amino]acetic acid (CID 112509512) is 2-[[3-(3,4-dimethylphenoxy)-2-methylpropanoyl]amino]acetic acid.
What is the SMILES notation for 2-[[3-(3,4-dimethylphenoxy)-2-methylpropanoyl]amino]acetic acid?
The canonical SMILES for 2-[[3-(3,4-dimethylphenoxy)-2-methylpropanoyl]amino]acetic acid is Cc1ccc(OCC(C)C(=O)NCC(=O)O)cc1C.
What is the InChIKey of 2-[[3-(3,4-dimethylphenoxy)-2-methylpropanoyl]amino]acetic acid?
The InChIKey is ITJBLKYXNAQCAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO4/c1-9-4-5-12(6-10(9)2)19-8-11(3)14(18)15-7-13(16)17/h4-6,11H,7-8H2,1-3H3,(H,15,18)(H,16,17).
What are the key properties of 2-[[3-(3,4-dimethylphenoxy)-2-methylpropanoyl]amino]acetic acid?
2-[[3-(3,4-dimethylphenoxy)-2-methylpropanoyl]amino]acetic acid has a molecular weight of 265.31 g/mol, XLogP of 1.52, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[3-(3,4-dimethylphenoxy)-2-methylpropanoyl]amino]acetic acid is sourced from PubChem (CID 112509512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).