C31H26Cl3NO10 — CID 11250967
[(2R,3R,4S,5S,6R)-2-(acetyloxymethyl)-4,5-dibenzoyloxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] benzoate (PubChem CID 11250967) has the molecular formula C31H26Cl3NO10 and a molecular weight of 678.91 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6R)-2-(acetyloxymethyl)-4,5-dibenzoyloxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] benzoate.
| Compound Name | [(2R,3R,4S,5S,6R)-2-(acetyloxymethyl)-4,5-dibenzoyloxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] benzoate |
|---|---|
| PubChem CID | 11250967 |
| Molecular Formula | C31H26Cl3NO10 |
| Molecular Weight | 678.91 g/mol |
| Exact Mass | 677.06 |
| IUPAC Name | [(2R,3R,4S,5S,6R)-2-(acetyloxymethyl)-4,5-dibenzoyloxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-3-yl] benzoate |
| SMILES | [H]/N=C(/O[C@H]1O[C@H](COC(C)=O)[C@@H](OC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C31H26Cl3NO10/c1-18(36)40-17-22-23(42-26(37)19-11-5-2-6-12-19)24(43-27(38)20-13-7-3-8-14-20)25(29(41-22)45-30(35)31(32,33)34)44-28(39)21-15-9-4-10-16-21/h2-16,22-25,29,35H,17H2,1H3/b35-30+/t22-,23-,24+,25+,29-/m1/s1 |
| InChIKey | LMPRSGVCSGTWDZ-MNQQCTGWSA-N |
| XLogP | 5.32 |
| TPSA | 147.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.91 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|