C15H25N — CID 112513140
1-(4-butan-2-ylphenyl)pentan-3-amine (PubChem CID 112513140) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is 1-(4-butan-2-ylphenyl)pentan-3-amine.
| Compound Name | 1-(4-butan-2-ylphenyl)pentan-3-amine |
|---|---|
| PubChem CID | 112513140 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | 1-(4-butan-2-ylphenyl)pentan-3-amine |
| SMILES | CCC(N)CCc1ccc(C(C)CC)cc1 |
| InChI | InChI=1S/C15H25N/c1-4-12(3)14-9-6-13(7-10-14)8-11-15(16)5-2/h6-7,9-10,12,15H,4-5,8,11,16H2,1-3H3 |
| InChIKey | PANKSMLCQICJDY-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |