C15H23NO2 — CID 112513393
1-[(4-cyclopentyloxyphenyl)methylamino]propan-2-ol (PubChem CID 112513393) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is 1-[(4-cyclopentyloxyphenyl)methylamino]propan-2-ol.
| Compound Name | 1-[(4-cyclopentyloxyphenyl)methylamino]propan-2-ol |
|---|---|
| PubChem CID | 112513393 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 1-[(4-cyclopentyloxyphenyl)methylamino]propan-2-ol |
| SMILES | CC(O)CNCc1ccc(OC2CCCC2)cc1 |
| InChI | InChI=1S/C15H23NO2/c1-12(17)10-16-11-13-6-8-15(9-7-13)18-14-4-2-3-5-14/h6-9,12,14,16-17H,2-5,10-11H2,1H3 |
| InChIKey | MLTYVTIMWJEUCB-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |