About 5-oxo-N-prop-2-enyl-1,2-dihydropyrazole-3-carboxamide
5-oxo-N-prop-2-enyl-1,2-dihydropyrazole-3-carboxamide (PubChem CID 112513804) has the molecular formula C7H9N3O2
and a molecular weight of 167.17 g/mol. Its IUPAC name is 5-oxo-N-prop-2-enyl-1,2-dihydropyrazole-3-carboxamide.
Molecular Properties
| Compound Name | 5-oxo-N-prop-2-enyl-1,2-dihydropyrazole-3-carboxamide |
| PubChem CID | 112513804 |
| Molecular Formula | C7H9N3O2 |
| Molecular Weight | 167.17 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | 5-oxo-N-prop-2-enyl-1,2-dihydropyrazole-3-carboxamide |
| SMILES | C=CCNC(=O)c1cc(=O)[nH][nH]1 |
| InChI | InChI=1S/C7H9N3O2/c1-2-3-8-7(12)5-4-6(11)10-9-5/h2,4H,1,3H2,(H,8,12)(H2,9,10,11) |
| InChIKey | GIGXRZJNHGLRSU-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.17 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-oxo-N-prop-2-enyl-1,2-dihydropyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-oxo-N-prop-2-enyl-1,2-dihydropyrazole-3-carboxamide?
The IUPAC name of 5-oxo-N-prop-2-enyl-1,2-dihydropyrazole-3-carboxamide (CID 112513804) is 5-oxo-N-prop-2-enyl-1,2-dihydropyrazole-3-carboxamide.
What is the SMILES notation for 5-oxo-N-prop-2-enyl-1,2-dihydropyrazole-3-carboxamide?
The canonical SMILES for 5-oxo-N-prop-2-enyl-1,2-dihydropyrazole-3-carboxamide is C=CCNC(=O)c1cc(=O)[nH][nH]1.
What is the InChIKey of 5-oxo-N-prop-2-enyl-1,2-dihydropyrazole-3-carboxamide?
The InChIKey is GIGXRZJNHGLRSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3O2/c1-2-3-8-7(12)5-4-6(11)10-9-5/h2,4H,1,3H2,(H,8,12)(H2,9,10,11).
What are the key properties of 5-oxo-N-prop-2-enyl-1,2-dihydropyrazole-3-carboxamide?
5-oxo-N-prop-2-enyl-1,2-dihydropyrazole-3-carboxamide has a molecular weight of 167.17 g/mol, XLogP of -0.38, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-oxo-N-prop-2-enyl-1,2-dihydropyrazole-3-carboxamide is sourced from PubChem (CID 112513804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).