C8H13N3O2 — CID 112513805
N-(2-methylpropyl)-5-oxo-1,2-dihydropyrazole-3-carboxamide (PubChem CID 112513805) has the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. Its IUPAC name is N-(2-methylpropyl)-5-oxo-1,2-dihydropyrazole-3-carboxamide.
| Compound Name | N-(2-methylpropyl)-5-oxo-1,2-dihydropyrazole-3-carboxamide |
|---|---|
| PubChem CID | 112513805 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | N-(2-methylpropyl)-5-oxo-1,2-dihydropyrazole-3-carboxamide |
| SMILES | CC(C)CNC(=O)c1cc(=O)[nH][nH]1 |
| InChI | InChI=1S/C8H13N3O2/c1-5(2)4-9-8(13)6-3-7(12)11-10-6/h3,5H,4H2,1-2H3,(H,9,13)(H2,10,11,12) |
| InChIKey | PXLQTRBVDBOTBR-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |