About 5-(pyrrolidine-1-carbonyl)-1,2-dihydropyrazol-3-one
5-(pyrrolidine-1-carbonyl)-1,2-dihydropyrazol-3-one (PubChem CID 112513806) has the molecular formula C8H11N3O2
and a molecular weight of 181.19 g/mol. Its IUPAC name is 5-(pyrrolidine-1-carbonyl)-1,2-dihydropyrazol-3-one.
Molecular Properties
| Compound Name | 5-(pyrrolidine-1-carbonyl)-1,2-dihydropyrazol-3-one |
| PubChem CID | 112513806 |
| Molecular Formula | C8H11N3O2 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 5-(pyrrolidine-1-carbonyl)-1,2-dihydropyrazol-3-one |
| SMILES | O=C(c1cc(=O)[nH][nH]1)N1CCCC1 |
| InChI | InChI=1S/C8H11N3O2/c12-7-5-6(9-10-7)8(13)11-3-1-2-4-11/h5H,1-4H2,(H2,9,10,12) |
| InChIKey | JVLNZWWGYXDMKZ-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 68.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(pyrrolidine-1-carbonyl)-1,2-dihydropyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(pyrrolidine-1-carbonyl)-1,2-dihydropyrazol-3-one?
The IUPAC name of 5-(pyrrolidine-1-carbonyl)-1,2-dihydropyrazol-3-one (CID 112513806) is 5-(pyrrolidine-1-carbonyl)-1,2-dihydropyrazol-3-one.
What is the SMILES notation for 5-(pyrrolidine-1-carbonyl)-1,2-dihydropyrazol-3-one?
The canonical SMILES for 5-(pyrrolidine-1-carbonyl)-1,2-dihydropyrazol-3-one is O=C(c1cc(=O)[nH][nH]1)N1CCCC1.
What is the InChIKey of 5-(pyrrolidine-1-carbonyl)-1,2-dihydropyrazol-3-one?
The InChIKey is JVLNZWWGYXDMKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O2/c12-7-5-6(9-10-7)8(13)11-3-1-2-4-11/h5H,1-4H2,(H2,9,10,12).
What are the key properties of 5-(pyrrolidine-1-carbonyl)-1,2-dihydropyrazol-3-one?
5-(pyrrolidine-1-carbonyl)-1,2-dihydropyrazol-3-one has a molecular weight of 181.19 g/mol, XLogP of -0.06, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(pyrrolidine-1-carbonyl)-1,2-dihydropyrazol-3-one is sourced from PubChem (CID 112513806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).