C13H18N2O3 — CID 112514600
methyl 4-[3-(methylamino)butanoylamino]benzoate (PubChem CID 112514600) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is methyl 4-[3-(methylamino)butanoylamino]benzoate.
| Compound Name | methyl 4-[3-(methylamino)butanoylamino]benzoate |
|---|---|
| PubChem CID | 112514600 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | methyl 4-[3-(methylamino)butanoylamino]benzoate |
| SMILES | CNC(C)CC(=O)Nc1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C13H18N2O3/c1-9(14-2)8-12(16)15-11-6-4-10(5-7-11)13(17)18-3/h4-7,9,14H,8H2,1-3H3,(H,15,16) |
| InChIKey | QSDIZDMVGCWOLK-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |