C14H20O4 — CID 112514675
2-[1-(3-methyl-4-propan-2-yloxyphenyl)ethoxy]acetic acid (PubChem CID 112514675) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is 2-[1-(3-methyl-4-propan-2-yloxyphenyl)ethoxy]acetic acid.
| Compound Name | 2-[1-(3-methyl-4-propan-2-yloxyphenyl)ethoxy]acetic acid |
|---|---|
| PubChem CID | 112514675 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 2-[1-(3-methyl-4-propan-2-yloxyphenyl)ethoxy]acetic acid |
| SMILES | Cc1cc(C(C)OCC(=O)O)ccc1OC(C)C |
| InChI | InChI=1S/C14H20O4/c1-9(2)18-13-6-5-12(7-10(13)3)11(4)17-8-14(15)16/h5-7,9,11H,8H2,1-4H3,(H,15,16) |
| InChIKey | XNVVIBZPWFOQED-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |