C15H19NOS — CID 112516897
4-(3-methylphenoxy)-3-thiophen-2-ylbutan-1-amine (PubChem CID 112516897) has the molecular formula C15H19NOS and a molecular weight of 261.39 g/mol. Its IUPAC name is 4-(3-methylphenoxy)-3-thiophen-2-ylbutan-1-amine.
| Compound Name | 4-(3-methylphenoxy)-3-thiophen-2-ylbutan-1-amine |
|---|---|
| PubChem CID | 112516897 |
| Molecular Formula | C15H19NOS |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 4-(3-methylphenoxy)-3-thiophen-2-ylbutan-1-amine |
| SMILES | Cc1cccc(OCC(CCN)c2cccs2)c1 |
| InChI | InChI=1S/C15H19NOS/c1-12-4-2-5-14(10-12)17-11-13(7-8-16)15-6-3-9-18-15/h2-6,9-10,13H,7-8,11,16H2,1H3 |
| InChIKey | OZKPRVZQPYLBLM-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |