About CID 11251726
CID 11251726 (PubChem CID 11251726) has the molecular formula C53H50Br4Si
and a molecular weight of 1034.68 g/mol.
Molecular Properties
| Compound Name | CID 11251726 |
| PubChem CID | 11251726 |
| Molecular Formula | C53H50Br4Si |
| Molecular Weight | 1034.68 g/mol |
| Exact Mass | 1030.04 |
| IUPAC Name | — |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1[C]c1c(Br)cc(C#Cc2cc(C#Cc3cc(Br)c([C]c4c(C)cc(C(C)(C)C)cc4C)c(Br)c3)cc(C#C[Si](C)(C)C)c2)cc1Br |
| InChI | InChI=1S/C53H50Br4Si/c1-33-20-42(52(5,6)7)21-34(2)44(33)31-46-48(54)27-39(28-49(46)55)16-14-37-24-38(26-41(25-37)18-19-58(11,12)13)15-17-40-29-50(56)47(51(57)30-40)32-45-35(3)22-43(23-36(45)4)53(8,9)10/h20-30H,1-13H3 |
| InChIKey | SPGPEORDZBASRT-UHFFFAOYSA-N |
| XLogP | 15.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 58 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1034.68 |
| LogP ≤ 5 | 15.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 11251726 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11251726?
The IUPAC name of CID 11251726 (CID 11251726) is not available.
What is the SMILES notation for CID 11251726?
The canonical SMILES for CID 11251726 is Cc1cc(C(C)(C)C)cc(C)c1[C]c1c(Br)cc(C#Cc2cc(C#Cc3cc(Br)c([C]c4c(C)cc(C(C)(C)C)cc4C)c(Br)c3)cc(C#C[Si](C)(C)C)c2)cc1Br.
What is the InChIKey of CID 11251726?
The InChIKey is SPGPEORDZBASRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C53H50Br4Si/c1-33-20-42(52(5,6)7)21-34(2)44(33)31-46-48(54)27-39(28-49(46)55)16-14-37-24-38(26-41(25-37)18-19-58(11,12)13)15-17-40-29-50(56)47(51(57)30-40)32-45-35(3)22-43(23-36(45)4)53(8,9)10/h20-30H,1-13H3.
What are the key properties of CID 11251726?
CID 11251726 has a molecular weight of 1034.68 g/mol, XLogP of 15.55, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11251726 is sourced from PubChem (CID 11251726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).