About [(E)-but-2-enyl] carbonochloridate
[(E)-but-2-enyl] carbonochloridate (PubChem CID 11252032) has the molecular formula C5H7ClO2
and a molecular weight of 134.56 g/mol. Its IUPAC name is [(E)-but-2-enyl] carbonochloridate.
Molecular Properties
| Compound Name | [(E)-but-2-enyl] carbonochloridate |
| PubChem CID | 11252032 |
| Molecular Formula | C5H7ClO2 |
| Molecular Weight | 134.56 g/mol |
| Exact Mass | 134.01 |
| IUPAC Name | [(E)-but-2-enyl] carbonochloridate |
| SMILES | C/C=C/COC(=O)Cl |
| InChI | InChI=1S/C5H7ClO2/c1-2-3-4-8-5(6)7/h2-3H,4H2,1H3/b3-2+ |
| InChIKey | ZQSWSIKNFRZKGQ-NSCUHMNNSA-N |
| XLogP | 1.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.56 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(E)-but-2-enyl] carbonochloridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-but-2-enyl] carbonochloridate?
The IUPAC name of [(E)-but-2-enyl] carbonochloridate (CID 11252032) is [(E)-but-2-enyl] carbonochloridate.
What is the SMILES notation for [(E)-but-2-enyl] carbonochloridate?
The canonical SMILES for [(E)-but-2-enyl] carbonochloridate is C/C=C/COC(=O)Cl.
What is the InChIKey of [(E)-but-2-enyl] carbonochloridate?
The InChIKey is ZQSWSIKNFRZKGQ-NSCUHMNNSA-N. The full InChI is InChI=1S/C5H7ClO2/c1-2-3-4-8-5(6)7/h2-3H,4H2,1H3/b3-2+.
What are the key properties of [(E)-but-2-enyl] carbonochloridate?
[(E)-but-2-enyl] carbonochloridate has a molecular weight of 134.56 g/mol, XLogP of 1.94, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-but-2-enyl] carbonochloridate is sourced from PubChem (CID 11252032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).