About 3-amino-4,4-dimethyl-1,5-dihydropyridazin-6-one
3-amino-4,4-dimethyl-1,5-dihydropyridazin-6-one (PubChem CID 11252062) has the molecular formula C6H11N3O
and a molecular weight of 141.17 g/mol. Its IUPAC name is 3-amino-4,4-dimethyl-1,5-dihydropyridazin-6-one.
Molecular Properties
| Compound Name | 3-amino-4,4-dimethyl-1,5-dihydropyridazin-6-one |
| PubChem CID | 11252062 |
| Molecular Formula | C6H11N3O |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.09 |
| IUPAC Name | 3-amino-4,4-dimethyl-1,5-dihydropyridazin-6-one |
| SMILES | CC1(C)CC(=O)NN=C1N |
| InChI | InChI=1S/C6H11N3O/c1-6(2)3-4(10)8-9-5(6)7/h3H2,1-2H3,(H2,7,9)(H,8,10) |
| InChIKey | DEWNWGRSXMDGDU-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-amino-4,4-dimethyl-1,5-dihydropyridazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-4,4-dimethyl-1,5-dihydropyridazin-6-one?
The IUPAC name of 3-amino-4,4-dimethyl-1,5-dihydropyridazin-6-one (CID 11252062) is 3-amino-4,4-dimethyl-1,5-dihydropyridazin-6-one.
What is the SMILES notation for 3-amino-4,4-dimethyl-1,5-dihydropyridazin-6-one?
The canonical SMILES for 3-amino-4,4-dimethyl-1,5-dihydropyridazin-6-one is CC1(C)CC(=O)NN=C1N.
What is the InChIKey of 3-amino-4,4-dimethyl-1,5-dihydropyridazin-6-one?
The InChIKey is DEWNWGRSXMDGDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3O/c1-6(2)3-4(10)8-9-5(6)7/h3H2,1-2H3,(H2,7,9)(H,8,10).
What are the key properties of 3-amino-4,4-dimethyl-1,5-dihydropyridazin-6-one?
3-amino-4,4-dimethyl-1,5-dihydropyridazin-6-one has a molecular weight of 141.17 g/mol, XLogP of -0.20, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4,4-dimethyl-1,5-dihydropyridazin-6-one is sourced from PubChem (CID 11252062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).