About 1-(2-methylprop-1-enyl)cyclopropane-1,2-dicarbonitrile
1-(2-methylprop-1-enyl)cyclopropane-1,2-dicarbonitrile (PubChem CID 11252087) has the molecular formula C9H10N2
and a molecular weight of 146.19 g/mol. Its IUPAC name is 1-(2-methylprop-1-enyl)cyclopropane-1,2-dicarbonitrile.
Molecular Properties
| Compound Name | 1-(2-methylprop-1-enyl)cyclopropane-1,2-dicarbonitrile |
| PubChem CID | 11252087 |
| Molecular Formula | C9H10N2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | 1-(2-methylprop-1-enyl)cyclopropane-1,2-dicarbonitrile |
| SMILES | CC(C)=CC1(C#N)CC1C#N |
| InChI | InChI=1S/C9H10N2/c1-7(2)3-9(6-11)4-8(9)5-10/h3,8H,4H2,1-2H3 |
| InChIKey | PAPFVBCMQARCCM-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-methylprop-1-enyl)cyclopropane-1,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methylprop-1-enyl)cyclopropane-1,2-dicarbonitrile?
The IUPAC name of 1-(2-methylprop-1-enyl)cyclopropane-1,2-dicarbonitrile (CID 11252087) is 1-(2-methylprop-1-enyl)cyclopropane-1,2-dicarbonitrile.
What is the SMILES notation for 1-(2-methylprop-1-enyl)cyclopropane-1,2-dicarbonitrile?
The canonical SMILES for 1-(2-methylprop-1-enyl)cyclopropane-1,2-dicarbonitrile is CC(C)=CC1(C#N)CC1C#N.
What is the InChIKey of 1-(2-methylprop-1-enyl)cyclopropane-1,2-dicarbonitrile?
The InChIKey is PAPFVBCMQARCCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2/c1-7(2)3-9(6-11)4-8(9)5-10/h3,8H,4H2,1-2H3.
What are the key properties of 1-(2-methylprop-1-enyl)cyclopropane-1,2-dicarbonitrile?
1-(2-methylprop-1-enyl)cyclopropane-1,2-dicarbonitrile has a molecular weight of 146.19 g/mol, XLogP of 2.01, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methylprop-1-enyl)cyclopropane-1,2-dicarbonitrile is sourced from PubChem (CID 11252087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).