About 3-(hydroxymethyl)-1,3-thiazolidine-2-thione
3-(hydroxymethyl)-1,3-thiazolidine-2-thione (PubChem CID 11252098) has the molecular formula C4H7NOS2
and a molecular weight of 149.24 g/mol. Its IUPAC name is 3-(hydroxymethyl)-1,3-thiazolidine-2-thione.
Molecular Properties
| Compound Name | 3-(hydroxymethyl)-1,3-thiazolidine-2-thione |
| PubChem CID | 11252098 |
| Molecular Formula | C4H7NOS2 |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.00 |
| IUPAC Name | 3-(hydroxymethyl)-1,3-thiazolidine-2-thione |
| SMILES | OCN1CCSC1=S |
| InChI | InChI=1S/C4H7NOS2/c6-3-5-1-2-8-4(5)7/h6H,1-3H2 |
| InChIKey | RIVFERQQRLRDSY-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(hydroxymethyl)-1,3-thiazolidine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(hydroxymethyl)-1,3-thiazolidine-2-thione?
The IUPAC name of 3-(hydroxymethyl)-1,3-thiazolidine-2-thione (CID 11252098) is 3-(hydroxymethyl)-1,3-thiazolidine-2-thione.
What is the SMILES notation for 3-(hydroxymethyl)-1,3-thiazolidine-2-thione?
The canonical SMILES for 3-(hydroxymethyl)-1,3-thiazolidine-2-thione is OCN1CCSC1=S.
What is the InChIKey of 3-(hydroxymethyl)-1,3-thiazolidine-2-thione?
The InChIKey is RIVFERQQRLRDSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NOS2/c6-3-5-1-2-8-4(5)7/h6H,1-3H2.
What are the key properties of 3-(hydroxymethyl)-1,3-thiazolidine-2-thione?
3-(hydroxymethyl)-1,3-thiazolidine-2-thione has a molecular weight of 149.24 g/mol, XLogP of 0.27, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(hydroxymethyl)-1,3-thiazolidine-2-thione is sourced from PubChem (CID 11252098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).