About butyl 2,3-dioxopropanoate
butyl 2,3-dioxopropanoate (PubChem CID 11252149) has the molecular formula C7H10O4
and a molecular weight of 158.15 g/mol. Its IUPAC name is butyl 2,3-dioxopropanoate.
Molecular Properties
| Compound Name | butyl 2,3-dioxopropanoate |
| PubChem CID | 11252149 |
| Molecular Formula | C7H10O4 |
| Molecular Weight | 158.15 g/mol |
| Exact Mass | 158.06 |
| IUPAC Name | butyl 2,3-dioxopropanoate |
| SMILES | CCCCOC(=O)C(=O)C=O |
| InChI | InChI=1S/C7H10O4/c1-2-3-4-11-7(10)6(9)5-8/h5H,2-4H2,1H3 |
| InChIKey | FJQPWTLSZCJUMR-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.15 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze butyl 2,3-dioxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 2,3-dioxopropanoate?
The IUPAC name of butyl 2,3-dioxopropanoate (CID 11252149) is butyl 2,3-dioxopropanoate.
What is the SMILES notation for butyl 2,3-dioxopropanoate?
The canonical SMILES for butyl 2,3-dioxopropanoate is CCCCOC(=O)C(=O)C=O.
What is the InChIKey of butyl 2,3-dioxopropanoate?
The InChIKey is FJQPWTLSZCJUMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O4/c1-2-3-4-11-7(10)6(9)5-8/h5H,2-4H2,1H3.
What are the key properties of butyl 2,3-dioxopropanoate?
butyl 2,3-dioxopropanoate has a molecular weight of 158.15 g/mol, XLogP of 0.10, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 2,3-dioxopropanoate is sourced from PubChem (CID 11252149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).