About 3-hydroxy-2-methyl-3H-pyrrolo[3,4-c]pyridin-1-one
3-hydroxy-2-methyl-3H-pyrrolo[3,4-c]pyridin-1-one (PubChem CID 11252187) has the molecular formula C8H8N2O2
and a molecular weight of 164.16 g/mol. Its IUPAC name is 3-hydroxy-2-methyl-3H-pyrrolo[3,4-c]pyridin-1-one.
Molecular Properties
| Compound Name | 3-hydroxy-2-methyl-3H-pyrrolo[3,4-c]pyridin-1-one |
| PubChem CID | 11252187 |
| Molecular Formula | C8H8N2O2 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | 3-hydroxy-2-methyl-3H-pyrrolo[3,4-c]pyridin-1-one |
| SMILES | CN1C(=O)c2ccncc2C1O |
| InChI | InChI=1S/C8H8N2O2/c1-10-7(11)5-2-3-9-4-6(5)8(10)12/h2-4,8,12H,1H3 |
| InChIKey | MVKALWANBHXUNK-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-hydroxy-2-methyl-3H-pyrrolo[3,4-c]pyridin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-2-methyl-3H-pyrrolo[3,4-c]pyridin-1-one?
The IUPAC name of 3-hydroxy-2-methyl-3H-pyrrolo[3,4-c]pyridin-1-one (CID 11252187) is 3-hydroxy-2-methyl-3H-pyrrolo[3,4-c]pyridin-1-one.
What is the SMILES notation for 3-hydroxy-2-methyl-3H-pyrrolo[3,4-c]pyridin-1-one?
The canonical SMILES for 3-hydroxy-2-methyl-3H-pyrrolo[3,4-c]pyridin-1-one is CN1C(=O)c2ccncc2C1O.
What is the InChIKey of 3-hydroxy-2-methyl-3H-pyrrolo[3,4-c]pyridin-1-one?
The InChIKey is MVKALWANBHXUNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O2/c1-10-7(11)5-2-3-9-4-6(5)8(10)12/h2-4,8,12H,1H3.
What are the key properties of 3-hydroxy-2-methyl-3H-pyrrolo[3,4-c]pyridin-1-one?
3-hydroxy-2-methyl-3H-pyrrolo[3,4-c]pyridin-1-one has a molecular weight of 164.16 g/mol, XLogP of 0.16, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-2-methyl-3H-pyrrolo[3,4-c]pyridin-1-one is sourced from PubChem (CID 11252187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).