About 4-methoxy-1H-pyrazolo[5,4-d]pyrimidin-6-amine
4-methoxy-1H-pyrazolo[5,4-d]pyrimidin-6-amine (PubChem CID 11252197) has the molecular formula C6H7N5O
and a molecular weight of 165.16 g/mol. Its IUPAC name is 4-methoxy-1H-pyrazolo[5,4-d]pyrimidin-6-amine.
Molecular Properties
| Compound Name | 4-methoxy-1H-pyrazolo[5,4-d]pyrimidin-6-amine |
| PubChem CID | 11252197 |
| Molecular Formula | C6H7N5O |
| Molecular Weight | 165.16 g/mol |
| Exact Mass | 165.07 |
| IUPAC Name | 4-methoxy-1H-pyrazolo[5,4-d]pyrimidin-6-amine |
| SMILES | COc1nc(N)nc2[nH]ncc12 |
| InChI | InChI=1S/C6H7N5O/c1-12-5-3-2-8-11-4(3)9-6(7)10-5/h2H,1H3,(H3,7,8,9,10,11) |
| InChIKey | JGSDDGDWMGPLPH-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.16 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-methoxy-1H-pyrazolo[5,4-d]pyrimidin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-1H-pyrazolo[5,4-d]pyrimidin-6-amine?
The IUPAC name of 4-methoxy-1H-pyrazolo[5,4-d]pyrimidin-6-amine (CID 11252197) is 4-methoxy-1H-pyrazolo[5,4-d]pyrimidin-6-amine.
What is the SMILES notation for 4-methoxy-1H-pyrazolo[5,4-d]pyrimidin-6-amine?
The canonical SMILES for 4-methoxy-1H-pyrazolo[5,4-d]pyrimidin-6-amine is COc1nc(N)nc2[nH]ncc12.
What is the InChIKey of 4-methoxy-1H-pyrazolo[5,4-d]pyrimidin-6-amine?
The InChIKey is JGSDDGDWMGPLPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N5O/c1-12-5-3-2-8-11-4(3)9-6(7)10-5/h2H,1H3,(H3,7,8,9,10,11).
What are the key properties of 4-methoxy-1H-pyrazolo[5,4-d]pyrimidin-6-amine?
4-methoxy-1H-pyrazolo[5,4-d]pyrimidin-6-amine has a molecular weight of 165.16 g/mol, XLogP of -0.06, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-1H-pyrazolo[5,4-d]pyrimidin-6-amine is sourced from PubChem (CID 11252197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).