C11H11Cl2N5O3S — CID 112523267
N-(2,5-dichlorophenyl)-2-[4-(methanesulfonamido)triazol-1-yl]acetamide (PubChem CID 112523267) has the molecular formula C11H11Cl2N5O3S and a molecular weight of 364.21 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-2-[4-(methanesulfonamido)triazol-1-yl]acetamide.
| Compound Name | N-(2,5-dichlorophenyl)-2-[4-(methanesulfonamido)triazol-1-yl]acetamide |
|---|---|
| PubChem CID | 112523267 |
| Molecular Formula | C11H11Cl2N5O3S |
| Molecular Weight | 364.21 g/mol |
| Exact Mass | 363.00 |
| IUPAC Name | N-(2,5-dichlorophenyl)-2-[4-(methanesulfonamido)triazol-1-yl]acetamide |
| SMILES | CS(=O)(=O)Nc1cn(CC(=O)Nc2cc(Cl)ccc2Cl)nn1 |
| InChI | InChI=1S/C11H11Cl2N5O3S/c1-22(20,21)16-10-5-18(17-15-10)6-11(19)14-9-4-7(12)2-3-8(9)13/h2-5,16H,6H2,1H3,(H,14,19) |
| InChIKey | CVZRADAXYANDTB-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.21 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |