C16H17N5O — CID 112523690
(6-amino-2-methylbenzimidazol-1-yl)-(5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-7-yl)methanone (PubChem CID 112523690) has the molecular formula C16H17N5O and a molecular weight of 295.35 g/mol. Its IUPAC name is (6-amino-2-methylbenzimidazol-1-yl)-(5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-7-yl)methanone.
| Compound Name | (6-amino-2-methylbenzimidazol-1-yl)-(5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-7-yl)methanone |
|---|---|
| PubChem CID | 112523690 |
| Molecular Formula | C16H17N5O |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | (6-amino-2-methylbenzimidazol-1-yl)-(5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-7-yl)methanone |
| SMILES | Cc1nc2ccc(N)cc2n1C(=O)C1CCn2cncc2C1 |
| InChI | InChI=1S/C16H17N5O/c1-10-19-14-3-2-12(17)7-15(14)21(10)16(22)11-4-5-20-9-18-8-13(20)6-11/h2-3,7-9,11H,4-6,17H2,1H3 |
| InChIKey | LLNNWQQWDAMXIC-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 78.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|