C14H14N4O — CID 112525218
(4-amino-3,5-dimethylpyrazol-1-yl)-(1H-indol-6-yl)methanone (PubChem CID 112525218) has the molecular formula C14H14N4O and a molecular weight of 254.29 g/mol. Its IUPAC name is (4-amino-3,5-dimethylpyrazol-1-yl)-(1H-indol-6-yl)methanone.
| Compound Name | (4-amino-3,5-dimethylpyrazol-1-yl)-(1H-indol-6-yl)methanone |
|---|---|
| PubChem CID | 112525218 |
| Molecular Formula | C14H14N4O |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | (4-amino-3,5-dimethylpyrazol-1-yl)-(1H-indol-6-yl)methanone |
| SMILES | Cc1nn(C(=O)c2ccc3cc[nH]c3c2)c(C)c1N |
| InChI | InChI=1S/C14H14N4O/c1-8-13(15)9(2)18(17-8)14(19)11-4-3-10-5-6-16-12(10)7-11/h3-7,16H,15H2,1-2H3 |
| InChIKey | NKJZXYMPNHHIOV-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 76.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |