About N-[1-[2-(3,5-dichloroanilino)-2-oxoethyl]triazol-4-yl]cyclopropanecarboxamide
N-[1-[2-(3,5-dichloroanilino)-2-oxoethyl]triazol-4-yl]cyclopropanecarboxamide (PubChem CID 112525391) has the molecular formula C14H13Cl2N5O2
and a molecular weight of 354.20 g/mol. Its IUPAC name is N-[1-[2-(3,5-dichloroanilino)-2-oxoethyl]triazol-4-yl]cyclopropanecarboxamide.
Molecular Properties
| Compound Name | N-[1-[2-(3,5-dichloroanilino)-2-oxoethyl]triazol-4-yl]cyclopropanecarboxamide |
| PubChem CID | 112525391 |
| Molecular Formula | C14H13Cl2N5O2 |
| Molecular Weight | 354.20 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | N-[1-[2-(3,5-dichloroanilino)-2-oxoethyl]triazol-4-yl]cyclopropanecarboxamide |
| SMILES | O=C(Cn1cc(NC(=O)C2CC2)nn1)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C14H13Cl2N5O2/c15-9-3-10(16)5-11(4-9)17-13(22)7-21-6-12(19-20-21)18-14(23)8-1-2-8/h3-6,8H,1-2,7H2,(H,17,22)(H,18,23) |
| InChIKey | RFOOJNIXCRSWEG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.20 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[1-[2-(3,5-dichloroanilino)-2-oxoethyl]triazol-4-yl]cyclopropanecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[2-(3,5-dichloroanilino)-2-oxoethyl]triazol-4-yl]cyclopropanecarboxamide?
The IUPAC name of N-[1-[2-(3,5-dichloroanilino)-2-oxoethyl]triazol-4-yl]cyclopropanecarboxamide (CID 112525391) is N-[1-[2-(3,5-dichloroanilino)-2-oxoethyl]triazol-4-yl]cyclopropanecarboxamide.
What is the SMILES notation for N-[1-[2-(3,5-dichloroanilino)-2-oxoethyl]triazol-4-yl]cyclopropanecarboxamide?
The canonical SMILES for N-[1-[2-(3,5-dichloroanilino)-2-oxoethyl]triazol-4-yl]cyclopropanecarboxamide is O=C(Cn1cc(NC(=O)C2CC2)nn1)Nc1cc(Cl)cc(Cl)c1.
What is the InChIKey of N-[1-[2-(3,5-dichloroanilino)-2-oxoethyl]triazol-4-yl]cyclopropanecarboxamide?
The InChIKey is RFOOJNIXCRSWEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13Cl2N5O2/c15-9-3-10(16)5-11(4-9)17-13(22)7-21-6-12(19-20-21)18-14(23)8-1-2-8/h3-6,8H,1-2,7H2,(H,17,22)(H,18,23).
What are the key properties of N-[1-[2-(3,5-dichloroanilino)-2-oxoethyl]triazol-4-yl]cyclopropanecarboxamide?
N-[1-[2-(3,5-dichloroanilino)-2-oxoethyl]triazol-4-yl]cyclopropanecarboxamide has a molecular weight of 354.20 g/mol, XLogP of 2.57, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[2-(3,5-dichloroanilino)-2-oxoethyl]triazol-4-yl]cyclopropanecarboxamide is sourced from PubChem (CID 112525391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).