C17H18N4O — CID 112526157
(5-amino-2-methylindol-1-yl)-(5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-7-yl)methanone (PubChem CID 112526157) has the molecular formula C17H18N4O and a molecular weight of 294.36 g/mol. Its IUPAC name is (5-amino-2-methylindol-1-yl)-(5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-7-yl)methanone.
| Compound Name | (5-amino-2-methylindol-1-yl)-(5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-7-yl)methanone |
|---|---|
| PubChem CID | 112526157 |
| Molecular Formula | C17H18N4O |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | (5-amino-2-methylindol-1-yl)-(5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-7-yl)methanone |
| SMILES | Cc1cc2cc(N)ccc2n1C(=O)C1CCn2cncc2C1 |
| InChI | InChI=1S/C17H18N4O/c1-11-6-13-7-14(18)2-3-16(13)21(11)17(22)12-4-5-20-10-19-9-15(20)8-12/h2-3,6-7,9-10,12H,4-5,8,18H2,1H3 |
| InChIKey | GAPJBEAYEYCJJQ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 65.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|