C19H18N4O2 — CID 112526635
1-[5-(7-aminoindole-1-carbonyl)-3,4-dihydro-1H-2,7-naphthyridin-2-yl]ethanone (PubChem CID 112526635) has the molecular formula C19H18N4O2 and a molecular weight of 334.38 g/mol. Its IUPAC name is 1-[5-(7-aminoindole-1-carbonyl)-3,4-dihydro-1H-2,7-naphthyridin-2-yl]ethanone.
| Compound Name | 1-[5-(7-aminoindole-1-carbonyl)-3,4-dihydro-1H-2,7-naphthyridin-2-yl]ethanone |
|---|---|
| PubChem CID | 112526635 |
| Molecular Formula | C19H18N4O2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 1-[5-(7-aminoindole-1-carbonyl)-3,4-dihydro-1H-2,7-naphthyridin-2-yl]ethanone |
| SMILES | CC(=O)N1CCc2c(cncc2C(=O)n2ccc3cccc(N)c32)C1 |
| InChI | InChI=1S/C19H18N4O2/c1-12(24)22-7-6-15-14(11-22)9-21-10-16(15)19(25)23-8-5-13-3-2-4-17(20)18(13)23/h2-5,8-10H,6-7,11,20H2,1H3 |
| InChIKey | VHAYPSHZFYVVNG-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|