About (4S,5R)-5-hydroxy-2-phenyl-1,3-dioxane-4-carbaldehyde
(4S,5R)-5-hydroxy-2-phenyl-1,3-dioxane-4-carbaldehyde (PubChem CID 11252764) has the molecular formula C11H12O4
and a molecular weight of 208.21 g/mol. Its IUPAC name is (4S,5R)-5-hydroxy-2-phenyl-1,3-dioxane-4-carbaldehyde.
Molecular Properties
| Compound Name | (4S,5R)-5-hydroxy-2-phenyl-1,3-dioxane-4-carbaldehyde |
| PubChem CID | 11252764 |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | (4S,5R)-5-hydroxy-2-phenyl-1,3-dioxane-4-carbaldehyde |
| SMILES | O=C[C@H]1OC(c2ccccc2)OC[C@H]1O |
| InChI | InChI=1S/C11H12O4/c12-6-10-9(13)7-14-11(15-10)8-4-2-1-3-5-8/h1-6,9-11,13H,7H2/t9-,10-,11?/m1/s1 |
| InChIKey | WGXOIVORNNWRAD-DIOIDXFWSA-N |
| XLogP | 0.66 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (4S,5R)-5-hydroxy-2-phenyl-1,3-dioxane-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S,5R)-5-hydroxy-2-phenyl-1,3-dioxane-4-carbaldehyde?
The IUPAC name of (4S,5R)-5-hydroxy-2-phenyl-1,3-dioxane-4-carbaldehyde (CID 11252764) is (4S,5R)-5-hydroxy-2-phenyl-1,3-dioxane-4-carbaldehyde.
What is the SMILES notation for (4S,5R)-5-hydroxy-2-phenyl-1,3-dioxane-4-carbaldehyde?
The canonical SMILES for (4S,5R)-5-hydroxy-2-phenyl-1,3-dioxane-4-carbaldehyde is O=C[C@H]1OC(c2ccccc2)OC[C@H]1O.
What is the InChIKey of (4S,5R)-5-hydroxy-2-phenyl-1,3-dioxane-4-carbaldehyde?
The InChIKey is WGXOIVORNNWRAD-DIOIDXFWSA-N. The full InChI is InChI=1S/C11H12O4/c12-6-10-9(13)7-14-11(15-10)8-4-2-1-3-5-8/h1-6,9-11,13H,7H2/t9-,10-,11?/m1/s1.
What are the key properties of (4S,5R)-5-hydroxy-2-phenyl-1,3-dioxane-4-carbaldehyde?
(4S,5R)-5-hydroxy-2-phenyl-1,3-dioxane-4-carbaldehyde has a molecular weight of 208.21 g/mol, XLogP of 0.66, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4S,5R)-5-hydroxy-2-phenyl-1,3-dioxane-4-carbaldehyde is sourced from PubChem (CID 11252764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).