C11H15NO3 — CID 11252786
methyl (1R,2R,4S,5S)-2,4-dimethyl-3-oxo-8-azabicyclo[3.2.1]oct-6-ene-8-carboxylate (PubChem CID 11252786) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is methyl (1R,2R,4S,5S)-2,4-dimethyl-3-oxo-8-azabicyclo[3.2.1]oct-6-ene-8-carboxylate.
| Compound Name | methyl (1R,2R,4S,5S)-2,4-dimethyl-3-oxo-8-azabicyclo[3.2.1]oct-6-ene-8-carboxylate |
|---|---|
| PubChem CID | 11252786 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | methyl (1R,2R,4S,5S)-2,4-dimethyl-3-oxo-8-azabicyclo[3.2.1]oct-6-ene-8-carboxylate |
| SMILES | COC(=O)N1[C@@H]2C=C[C@H]1[C@H](C)C(=O)[C@@H]2C |
| InChI | InChI=1S/C11H15NO3/c1-6-8-4-5-9(7(2)10(6)13)12(8)11(14)15-3/h4-9H,1-3H3/t6-,7+,8-,9+ |
| InChIKey | HCNATPBJQHLMJJ-SPJNRGJMSA-N |
| XLogP | 1.22 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|