About [4-(aminomethyl)-3,5-dimethylpyrazol-1-yl]-(5-methyl-1,3-oxazol-2-yl)methanone
[4-(aminomethyl)-3,5-dimethylpyrazol-1-yl]-(5-methyl-1,3-oxazol-2-yl)methanone (PubChem CID 112528460) has the molecular formula C11H14N4O2
and a molecular weight of 234.26 g/mol. Its IUPAC name is [4-(aminomethyl)-3,5-dimethylpyrazol-1-yl]-(5-methyl-1,3-oxazol-2-yl)methanone.
Molecular Properties
| Compound Name | [4-(aminomethyl)-3,5-dimethylpyrazol-1-yl]-(5-methyl-1,3-oxazol-2-yl)methanone |
| PubChem CID | 112528460 |
| Molecular Formula | C11H14N4O2 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | [4-(aminomethyl)-3,5-dimethylpyrazol-1-yl]-(5-methyl-1,3-oxazol-2-yl)methanone |
| SMILES | Cc1cnc(C(=O)n2nc(C)c(CN)c2C)o1 |
| InChI | InChI=1S/C11H14N4O2/c1-6-5-13-10(17-6)11(16)15-8(3)9(4-12)7(2)14-15/h5H,4,12H2,1-3H3 |
| InChIKey | MZIZWMAMOXYTNE-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 86.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [4-(aminomethyl)-3,5-dimethylpyrazol-1-yl]-(5-methyl-1,3-oxazol-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(aminomethyl)-3,5-dimethylpyrazol-1-yl]-(5-methyl-1,3-oxazol-2-yl)methanone?
The IUPAC name of [4-(aminomethyl)-3,5-dimethylpyrazol-1-yl]-(5-methyl-1,3-oxazol-2-yl)methanone (CID 112528460) is [4-(aminomethyl)-3,5-dimethylpyrazol-1-yl]-(5-methyl-1,3-oxazol-2-yl)methanone.
What is the SMILES notation for [4-(aminomethyl)-3,5-dimethylpyrazol-1-yl]-(5-methyl-1,3-oxazol-2-yl)methanone?
The canonical SMILES for [4-(aminomethyl)-3,5-dimethylpyrazol-1-yl]-(5-methyl-1,3-oxazol-2-yl)methanone is Cc1cnc(C(=O)n2nc(C)c(CN)c2C)o1.
What is the InChIKey of [4-(aminomethyl)-3,5-dimethylpyrazol-1-yl]-(5-methyl-1,3-oxazol-2-yl)methanone?
The InChIKey is MZIZWMAMOXYTNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4O2/c1-6-5-13-10(17-6)11(16)15-8(3)9(4-12)7(2)14-15/h5H,4,12H2,1-3H3.
What are the key properties of [4-(aminomethyl)-3,5-dimethylpyrazol-1-yl]-(5-methyl-1,3-oxazol-2-yl)methanone?
[4-(aminomethyl)-3,5-dimethylpyrazol-1-yl]-(5-methyl-1,3-oxazol-2-yl)methanone has a molecular weight of 234.26 g/mol, XLogP of 0.94, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(aminomethyl)-3,5-dimethylpyrazol-1-yl]-(5-methyl-1,3-oxazol-2-yl)methanone is sourced from PubChem (CID 112528460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).