C17H21N5O — CID 112528726
N-[(2,4,6-trimethylpyrimidin-5-yl)methyl]-5,6,7,8-tetrahydro-2,7-naphthyridine-4-carboxamide (PubChem CID 112528726) has the molecular formula C17H21N5O and a molecular weight of 311.39 g/mol. Its IUPAC name is N-[(2,4,6-trimethylpyrimidin-5-yl)methyl]-5,6,7,8-tetrahydro-2,7-naphthyridine-4-carboxamide.
| Compound Name | N-[(2,4,6-trimethylpyrimidin-5-yl)methyl]-5,6,7,8-tetrahydro-2,7-naphthyridine-4-carboxamide |
|---|---|
| PubChem CID | 112528726 |
| Molecular Formula | C17H21N5O |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | N-[(2,4,6-trimethylpyrimidin-5-yl)methyl]-5,6,7,8-tetrahydro-2,7-naphthyridine-4-carboxamide |
| SMILES | Cc1nc(C)c(CNC(=O)c2cncc3c2CCNC3)c(C)n1 |
| InChI | InChI=1S/C17H21N5O/c1-10-15(11(2)22-12(3)21-10)9-20-17(23)16-8-19-7-13-6-18-5-4-14(13)16/h7-8,18H,4-6,9H2,1-3H3,(H,20,23) |
| InChIKey | IDGLENLNUNUOSH-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |