C23H28N2O3 — CID 112529669
3-(3,4-dimethoxyphenyl)-2-methyl-N-[2-(2-methyl-1H-indol-3-yl)ethyl]propanamide (PubChem CID 112529669) has the molecular formula C23H28N2O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-2-methyl-N-[2-(2-methyl-1H-indol-3-yl)ethyl]propanamide.
| Compound Name | 3-(3,4-dimethoxyphenyl)-2-methyl-N-[2-(2-methyl-1H-indol-3-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 112529669 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-2-methyl-N-[2-(2-methyl-1H-indol-3-yl)ethyl]propanamide |
| SMILES | COc1ccc(CC(C)C(=O)NCCc2c(C)[nH]c3ccccc23)cc1OC |
| InChI | InChI=1S/C23H28N2O3/c1-15(13-17-9-10-21(27-3)22(14-17)28-4)23(26)24-12-11-18-16(2)25-20-8-6-5-7-19(18)20/h5-10,14-15,25H,11-13H2,1-4H3,(H,24,26) |
| InChIKey | VCXAPTWDXMHITO-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|