C19H25N5O3 — CID 112529860
5-N-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-2-N,2-N-dimethyl-3,4-dihydro-1H-2,7-naphthyridine-2,5-dicarboxamide (PubChem CID 112529860) has the molecular formula C19H25N5O3 and a molecular weight of 371.44 g/mol. Its IUPAC name is 5-N-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-2-N,2-N-dimethyl-3,4-dihydro-1H-2,7-naphthyridine-2,5-dicarboxamide.
| Compound Name | 5-N-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-2-N,2-N-dimethyl-3,4-dihydro-1H-2,7-naphthyridine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 112529860 |
| Molecular Formula | C19H25N5O3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | 5-N-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-2-N,2-N-dimethyl-3,4-dihydro-1H-2,7-naphthyridine-2,5-dicarboxamide |
| SMILES | Cc1noc(C)c1CCNC(=O)c1cncc2c1CCN(C(=O)N(C)C)C2 |
| InChI | InChI=1S/C19H25N5O3/c1-12-15(13(2)27-22-12)5-7-21-18(25)17-10-20-9-14-11-24(8-6-16(14)17)19(26)23(3)4/h9-10H,5-8,11H2,1-4H3,(H,21,25) |
| InChIKey | SGXVTLGAUBPIQE-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |