C13H20N4O3S — CID 112531128
N-[[4-(4-aminopiperidine-1-carbonyl)-2-pyridinyl]methyl]methanesulfonamide (PubChem CID 112531128) has the molecular formula C13H20N4O3S and a molecular weight of 312.40 g/mol. Its IUPAC name is N-[[4-(4-aminopiperidine-1-carbonyl)-2-pyridinyl]methyl]methanesulfonamide.
| Compound Name | N-[[4-(4-aminopiperidine-1-carbonyl)-2-pyridinyl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 112531128 |
| Molecular Formula | C13H20N4O3S |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | N-[[4-(4-aminopiperidine-1-carbonyl)-2-pyridinyl]methyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCc1cc(C(=O)N2CCC(N)CC2)ccn1 |
| InChI | InChI=1S/C13H20N4O3S/c1-21(19,20)16-9-12-8-10(2-5-15-12)13(18)17-6-3-11(14)4-7-17/h2,5,8,11,16H,3-4,6-7,9,14H2,1H3 |
| InChIKey | QYQLTQXMNNLEKS-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |