About 3-[2-[2-(3-hydroxyazetidin-1-yl)-2-oxoethyl]triazol-4-yl]-1,1-dimethylurea
3-[2-[2-(3-hydroxyazetidin-1-yl)-2-oxoethyl]triazol-4-yl]-1,1-dimethylurea (PubChem CID 112531410) has the molecular formula C10H16N6O3
and a molecular weight of 268.28 g/mol. Its IUPAC name is 3-[2-[2-(3-hydroxyazetidin-1-yl)-2-oxoethyl]triazol-4-yl]-1,1-dimethylurea.
Molecular Properties
| Compound Name | 3-[2-[2-(3-hydroxyazetidin-1-yl)-2-oxoethyl]triazol-4-yl]-1,1-dimethylurea |
| PubChem CID | 112531410 |
| Molecular Formula | C10H16N6O3 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 3-[2-[2-(3-hydroxyazetidin-1-yl)-2-oxoethyl]triazol-4-yl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)Nc1cnn(CC(=O)N2CC(O)C2)n1 |
| InChI | InChI=1S/C10H16N6O3/c1-14(2)10(19)12-8-3-11-16(13-8)6-9(18)15-4-7(17)5-15/h3,7,17H,4-6H2,1-2H3,(H,12,13,19) |
| InChIKey | BRZBHEHUAWNOTB-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[2-[2-(3-hydroxyazetidin-1-yl)-2-oxoethyl]triazol-4-yl]-1,1-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[2-(3-hydroxyazetidin-1-yl)-2-oxoethyl]triazol-4-yl]-1,1-dimethylurea?
The IUPAC name of 3-[2-[2-(3-hydroxyazetidin-1-yl)-2-oxoethyl]triazol-4-yl]-1,1-dimethylurea (CID 112531410) is 3-[2-[2-(3-hydroxyazetidin-1-yl)-2-oxoethyl]triazol-4-yl]-1,1-dimethylurea.
What is the SMILES notation for 3-[2-[2-(3-hydroxyazetidin-1-yl)-2-oxoethyl]triazol-4-yl]-1,1-dimethylurea?
The canonical SMILES for 3-[2-[2-(3-hydroxyazetidin-1-yl)-2-oxoethyl]triazol-4-yl]-1,1-dimethylurea is CN(C)C(=O)Nc1cnn(CC(=O)N2CC(O)C2)n1.
What is the InChIKey of 3-[2-[2-(3-hydroxyazetidin-1-yl)-2-oxoethyl]triazol-4-yl]-1,1-dimethylurea?
The InChIKey is BRZBHEHUAWNOTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N6O3/c1-14(2)10(19)12-8-3-11-16(13-8)6-9(18)15-4-7(17)5-15/h3,7,17H,4-6H2,1-2H3,(H,12,13,19).
What are the key properties of 3-[2-[2-(3-hydroxyazetidin-1-yl)-2-oxoethyl]triazol-4-yl]-1,1-dimethylurea?
3-[2-[2-(3-hydroxyazetidin-1-yl)-2-oxoethyl]triazol-4-yl]-1,1-dimethylurea has a molecular weight of 268.28 g/mol, XLogP of -1.43, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[2-(3-hydroxyazetidin-1-yl)-2-oxoethyl]triazol-4-yl]-1,1-dimethylurea is sourced from PubChem (CID 112531410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).