C8H15N5O4S — CID 112531455
N-(2-hydroxyethyl)-2-[4-(methanesulfonamido)triazol-1-yl]-N-methylacetamide (PubChem CID 112531455) has the molecular formula C8H15N5O4S and a molecular weight of 277.31 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-2-[4-(methanesulfonamido)triazol-1-yl]-N-methylacetamide.
| Compound Name | N-(2-hydroxyethyl)-2-[4-(methanesulfonamido)triazol-1-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 112531455 |
| Molecular Formula | C8H15N5O4S |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | N-(2-hydroxyethyl)-2-[4-(methanesulfonamido)triazol-1-yl]-N-methylacetamide |
| SMILES | CN(CCO)C(=O)Cn1cc(NS(C)(=O)=O)nn1 |
| InChI | InChI=1S/C8H15N5O4S/c1-12(3-4-14)8(15)6-13-5-7(9-11-13)10-18(2,16)17/h5,10,14H,3-4,6H2,1-2H3 |
| InChIKey | IWZVEBXRNZWVAV-UHFFFAOYSA-N |
| XLogP | -1.90 |
| TPSA | 117.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |