C14H23N5O3 — CID 112531833
N-[1-[2-[3-(hydroxymethyl)piperidin-1-yl]-2-oxoethyl]triazol-4-yl]-2-methylpropanamide (PubChem CID 112531833) has the molecular formula C14H23N5O3 and a molecular weight of 309.37 g/mol. Its IUPAC name is N-[1-[2-[3-(hydroxymethyl)piperidin-1-yl]-2-oxoethyl]triazol-4-yl]-2-methylpropanamide.
| Compound Name | N-[1-[2-[3-(hydroxymethyl)piperidin-1-yl]-2-oxoethyl]triazol-4-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 112531833 |
| Molecular Formula | C14H23N5O3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | N-[1-[2-[3-(hydroxymethyl)piperidin-1-yl]-2-oxoethyl]triazol-4-yl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)Nc1cn(CC(=O)N2CCCC(CO)C2)nn1 |
| InChI | InChI=1S/C14H23N5O3/c1-10(2)14(22)15-12-7-19(17-16-12)8-13(21)18-5-3-4-11(6-18)9-20/h7,10-11,20H,3-6,8-9H2,1-2H3,(H,15,22) |
| InChIKey | RNDCYAOCQNBGMZ-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |